C35H47F2N3O5 — CID 166086910
(Z)-4-(2,4-difluorophenyl)-N-[1-(4-hydroxy-4-methylcyclohexyl)-3-(2-oxoethyl)azetidin-3-yl]-4-methoxy-2-methylidenebut-3-enamide;2-(2-methoxyphenyl)-N-methylpropan-2-amine (PubChem CID 166086910) has the molecular formula C35H47F2N3O5 and a molecular weight of 627.77 g/mol. Its IUPAC name is (Z)-4-(2,4-difluorophenyl)-N-[1-(4-hydroxy-4-methylcyclohexyl)-3-(2-oxoethyl)azetidin-3-yl]-4-methoxy-2-methylidenebut-3-enamide;2-(2-methoxyphenyl)-N-methylpropan-2-amine.
| Compound Name | (Z)-4-(2,4-difluorophenyl)-N-[1-(4-hydroxy-4-methylcyclohexyl)-3-(2-oxoethyl)azetidin-3-yl]-4-methoxy-2-methylidenebut-3-enamide;2-(2-methoxyphenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 166086910 |
| Molecular Formula | C35H47F2N3O5 |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | (Z)-4-(2,4-difluorophenyl)-N-[1-(4-hydroxy-4-methylcyclohexyl)-3-(2-oxoethyl)azetidin-3-yl]-4-methoxy-2-methylidenebut-3-enamide;2-(2-methoxyphenyl)-N-methylpropan-2-amine |
| SMILES | C=C(/C=C(\OC)c1ccc(F)cc1F)C(=O)NC1(CC=O)CN(C2CCC(C)(O)CC2)C1.CNC(C)(C)c1ccccc1OC |
| InChI | InChI=1S/C24H30F2N2O4.C11H17NO/c1-16(12-21(32-3)19-5-4-17(25)13-20(19)26)22(30)27-24(10-11-29)14-28(15-24)18-6-8-23(2,31)9-7-18;1-11(2,12-3)9-7-5-6-8-10(9)13-4/h4-5,11-13,18,31H,1,6-10,14-15H2,2-3H3,(H,27,30);5-8,12H,1-4H3/b21-12-; |
| InChIKey | CGSMJVGIBIHIOS-SDKPGJOKSA-N |
| XLogP | 5.11 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|