C27H38FN2OP — CID 166086964
(Z)-4-(2-fluoro-4-methylphenyl)-N-[1-(4-methylcyclohexyl)-3-(2-methylprop-2-enyl)azetidin-3-yl]-2-methylidene-4-methylphosphanylbut-3-enamide (PubChem CID 166086964) has the molecular formula C27H38FN2OP and a molecular weight of 456.59 g/mol. Its IUPAC name is (Z)-4-(2-fluoro-4-methylphenyl)-N-[1-(4-methylcyclohexyl)-3-(2-methylprop-2-enyl)azetidin-3-yl]-2-methylidene-4-methylphosphanylbut-3-enamide.
| Compound Name | (Z)-4-(2-fluoro-4-methylphenyl)-N-[1-(4-methylcyclohexyl)-3-(2-methylprop-2-enyl)azetidin-3-yl]-2-methylidene-4-methylphosphanylbut-3-enamide |
|---|---|
| PubChem CID | 166086964 |
| Molecular Formula | C27H38FN2OP |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (Z)-4-(2-fluoro-4-methylphenyl)-N-[1-(4-methylcyclohexyl)-3-(2-methylprop-2-enyl)azetidin-3-yl]-2-methylidene-4-methylphosphanylbut-3-enamide |
| SMILES | C=C(C)CC1(NC(=O)C(=C)/C=C(\PC)c2ccc(C)cc2F)CN(C2CCC(C)CC2)C1 |
| InChI | InChI=1S/C27H38FN2OP/c1-18(2)15-27(16-30(17-27)22-10-7-19(3)8-11-22)29-26(31)21(5)14-25(32-6)23-12-9-20(4)13-24(23)28/h9,12-14,19,22,32H,1,5,7-8,10-11,15-17H2,2-4,6H3,(H,29,31)/b25-14- |
| InChIKey | BLUURQMVIVHZJN-QFEZKATASA-N |
| XLogP | 6.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|