C21H21F2N3O — CID 166090519
4-[3-[[4-(3,5-difluorophenyl)phenyl]methyl]-1-hydroxypyrazol-4-yl]piperidine (PubChem CID 166090519) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[3-[[4-(3,5-difluorophenyl)phenyl]methyl]-1-hydroxypyrazol-4-yl]piperidine.
| Compound Name | 4-[3-[[4-(3,5-difluorophenyl)phenyl]methyl]-1-hydroxypyrazol-4-yl]piperidine |
|---|---|
| PubChem CID | 166090519 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[3-[[4-(3,5-difluorophenyl)phenyl]methyl]-1-hydroxypyrazol-4-yl]piperidine |
| SMILES | On1cc(C2CCNCC2)c(Cc2ccc(-c3cc(F)cc(F)c3)cc2)n1 |
| InChI | InChI=1S/C21H21F2N3O/c22-18-10-17(11-19(23)12-18)15-3-1-14(2-4-15)9-21-20(13-26(27)25-21)16-5-7-24-8-6-16/h1-4,10-13,16,24,27H,5-9H2 |
| InChIKey | DHOZLMDQFFPVHC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|