C18H24FN3 — CID 18187705
4-[3-[(4-fluorophenyl)methyl]-1-propylpyrazol-5-yl]piperidine (PubChem CID 18187705) has the molecular formula C18H24FN3 and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)methyl]-1-propylpyrazol-5-yl]piperidine.
| Compound Name | 4-[3-[(4-fluorophenyl)methyl]-1-propylpyrazol-5-yl]piperidine |
|---|---|
| PubChem CID | 18187705 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)methyl]-1-propylpyrazol-5-yl]piperidine |
| SMILES | CCCn1nc(Cc2ccc(F)cc2)cc1C1CCNCC1 |
| InChI | InChI=1S/C18H24FN3/c1-2-11-22-18(15-7-9-20-10-8-15)13-17(21-22)12-14-3-5-16(19)6-4-14/h3-6,13,15,20H,2,7-12H2,1H3 |
| InChIKey | GKXHSOOQDILMCV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |