C16H21N3 — CID 18187656
4-(3-benzyl-1-methylpyrazol-5-yl)piperidine (PubChem CID 18187656) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-(3-benzyl-1-methylpyrazol-5-yl)piperidine.
| Compound Name | 4-(3-benzyl-1-methylpyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 18187656 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-(3-benzyl-1-methylpyrazol-5-yl)piperidine |
| SMILES | Cn1nc(Cc2ccccc2)cc1C1CCNCC1 |
| InChI | InChI=1S/C16H21N3/c1-19-16(14-7-9-17-10-8-14)12-15(18-19)11-13-5-3-2-4-6-13/h2-6,12,14,17H,7-11H2,1H3 |
| InChIKey | YPUAACSMIGNMJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |