C26H23Cl2N5OS — CID 166091024
3-chloro-2-(2-chloroethoxy)-5-[2-[4-[2-(methylsulfanylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]propan-2-yl]benzonitrile (PubChem CID 166091024) has the molecular formula C26H23Cl2N5OS and a molecular weight of 524.48 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[2-(methylsulfanylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[2-(methylsulfanylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166091024 |
| Molecular Formula | C26H23Cl2N5OS |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[2-(methylsulfanylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]propan-2-yl]benzonitrile |
| SMILES | CSNc1ncc2cc(-c3ccc(C(C)(C)c4cc(Cl)c(OCCCl)c(C#N)c4)cc3)cnc2n1 |
| InChI | InChI=1S/C26H23Cl2N5OS/c1-26(2,21-11-17(13-29)23(22(28)12-21)34-9-8-27)20-6-4-16(5-7-20)18-10-19-15-31-25(33-35-3)32-24(19)30-14-18/h4-7,10-12,14-15H,8-9H2,1-3H3,(H,30,31,32,33) |
| InChIKey | ODTCAFBUHRCAPP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|