C24H24Cl2N4O2S — CID 146520872
3-chloro-2-(2-chloroethoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]oxymethyl]phenyl]propan-2-yl]benzonitrile (PubChem CID 146520872) has the molecular formula C24H24Cl2N4O2S and a molecular weight of 503.46 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]oxymethyl]phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]oxymethyl]phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 146520872 |
| Molecular Formula | C24H24Cl2N4O2S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]oxymethyl]phenyl]propan-2-yl]benzonitrile |
| SMILES | CSNc1nccc(OCc2ccc(C(C)(C)c3cc(Cl)c(OCCCl)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C24H24Cl2N4O2S/c1-24(2,19-12-17(14-27)22(20(26)13-19)31-11-9-25)18-6-4-16(5-7-18)15-32-21-8-10-28-23(29-21)30-33-3/h4-8,10,12-13H,9,11,15H2,1-3H3,(H,28,29,30) |
| InChIKey | QGRDMJOWQJNBTJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|