C26H29ClN4O3S — CID 166090921
3-chloro-2-(2-hydroxybutoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]benzonitrile (PubChem CID 166090921) has the molecular formula C26H29ClN4O3S and a molecular weight of 513.06 g/mol. Its IUPAC name is 3-chloro-2-(2-hydroxybutoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-hydroxybutoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166090921 |
| Molecular Formula | C26H29ClN4O3S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 3-chloro-2-(2-hydroxybutoxy)-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]benzonitrile |
| SMILES | CCC(O)COc1c(Cl)cc(C(C)(C)c2ccc(OCc3ccnc(NSC)n3)cc2)cc1C#N |
| InChI | InChI=1S/C26H29ClN4O3S/c1-5-21(32)16-34-24-17(14-28)12-19(13-23(24)27)26(2,3)18-6-8-22(9-7-18)33-15-20-10-11-29-25(30-20)31-35-4/h6-13,21,32H,5,15-16H2,1-4H3,(H,29,30,31) |
| InChIKey | YEDYHGVAWLZNTR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|