C24H25ClN5O2S+ — CID 169251870
[[4-[[4-[2-(3-chloro-5-cyano-4-ethenylphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]amino]-hydroxy-methyl-sulfanylazanium (PubChem CID 169251870) has the molecular formula C24H25ClN5O2S+ and a molecular weight of 483.02 g/mol. Its IUPAC name is [[4-[[4-[2-(3-chloro-5-cyano-4-ethenylphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]amino]-hydroxy-methyl-sulfanylazanium.
| Compound Name | [[4-[[4-[2-(3-chloro-5-cyano-4-ethenylphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]amino]-hydroxy-methyl-sulfanylazanium |
|---|---|
| PubChem CID | 169251870 |
| Molecular Formula | C24H25ClN5O2S+ |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | [[4-[[4-[2-(3-chloro-5-cyano-4-ethenylphenyl)propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]amino]-hydroxy-methyl-sulfanylazanium |
| SMILES | C=Cc1c(Cl)cc(C(C)(C)c2ccc(OCc3ccnc(N[N+](C)(O)S)n3)cc2)cc1C#N |
| InChI | InChI=1S/C24H25ClN5O2S/c1-5-21-16(14-26)12-18(13-22(21)25)24(2,3)17-6-8-20(9-7-17)32-15-19-10-11-27-23(28-19)29-30(4,31)33/h5-13,31,33H,1,15H2,2-4H3,(H,27,28,29)/q+1 |
| InChIKey | NXEGTNZVOLVZGS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|