C26H28FN5O2S — CID 166091087
3-fluoro-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]-2-morpholin-4-ylbenzonitrile (PubChem CID 166091087) has the molecular formula C26H28FN5O2S and a molecular weight of 493.61 g/mol. Its IUPAC name is 3-fluoro-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]-2-morpholin-4-ylbenzonitrile.
| Compound Name | 3-fluoro-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]-2-morpholin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 166091087 |
| Molecular Formula | C26H28FN5O2S |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 3-fluoro-5-[2-[4-[[2-(methylsulfanylamino)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]-2-morpholin-4-ylbenzonitrile |
| SMILES | CSNc1nccc(COc2ccc(C(C)(C)c3cc(F)c(N4CCOCC4)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C26H28FN5O2S/c1-26(2,20-14-18(16-28)24(23(27)15-20)32-10-12-33-13-11-32)19-4-6-22(7-5-19)34-17-21-8-9-29-25(30-21)31-35-3/h4-9,14-15H,10-13,17H2,1-3H3,(H,29,30,31) |
| InChIKey | COPDBDYUFNTSOL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|