C29H32ClN3O5S — CID 172853975
2-[5-[2-chloro-6-cyano-4-[2-[4-[(2-methylsulfanylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid (PubChem CID 172853975) has the molecular formula C29H32ClN3O5S and a molecular weight of 570.11 g/mol. Its IUPAC name is 2-[5-[2-chloro-6-cyano-4-[2-[4-[(2-methylsulfanylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid.
| Compound Name | 2-[5-[2-chloro-6-cyano-4-[2-[4-[(2-methylsulfanylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid |
|---|---|
| PubChem CID | 172853975 |
| Molecular Formula | C29H32ClN3O5S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-[5-[2-chloro-6-cyano-4-[2-[4-[(2-methylsulfanylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid |
| SMILES | CSc1nccc(COc2ccc(C(C)(C)c3cc(Cl)c(OCCCCCOCC(=O)O)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C29H32ClN3O5S/c1-29(2,21-7-9-24(10-8-21)38-18-23-11-12-32-28(33-23)39-3)22-15-20(17-31)27(25(30)16-22)37-14-6-4-5-13-36-19-26(34)35/h7-12,15-16H,4-6,13-14,18-19H2,1-3H3,(H,34,35) |
| InChIKey | YLFWLONJYNLZSL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|