C23H22Cl2N4O2 — CID 166044804
5-[2-[4-[(3-aminopyrazin-2-yl)methoxy]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile (PubChem CID 166044804) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 5-[2-[4-[(3-aminopyrazin-2-yl)methoxy]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile.
| Compound Name | 5-[2-[4-[(3-aminopyrazin-2-yl)methoxy]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile |
|---|---|
| PubChem CID | 166044804 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-[2-[4-[(3-aminopyrazin-2-yl)methoxy]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile |
| SMILES | CC(C)(c1ccc(OCc2nccnc2N)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-23(2,17-11-15(13-26)21(19(25)12-17)30-10-7-24)16-3-5-18(6-4-16)31-14-20-22(27)29-9-8-28-20/h3-6,8-9,11-12H,7,10,14H2,1-2H3,(H2,27,29) |
| InChIKey | KJAIVVZLVJXRBQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|