C24H20Cl2N2O3 — CID 158742312
3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(4-ethynyl-1,3-oxazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile (PubChem CID 158742312) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(4-ethynyl-1,3-oxazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(4-ethynyl-1,3-oxazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 158742312 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(4-ethynyl-1,3-oxazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile |
| SMILES | C#Cc1coc(COc2ccc(C(C)(C)c3cc(Cl)c(OCCCl)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C24H20Cl2N2O3/c1-4-19-14-31-22(28-19)15-30-20-7-5-17(6-8-20)24(2,3)18-11-16(13-27)23(21(26)12-18)29-10-9-25/h1,5-8,11-12,14H,9-10,15H2,2-3H3 |
| InChIKey | KHNUAPORJMJRRP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|