C24H25Cl2N2O3PS — CID 168874066
3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(5-dimethylphosphoryl-1,3-thiazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile (PubChem CID 168874066) has the molecular formula C24H25Cl2N2O3PS and a molecular weight of 523.42 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(5-dimethylphosphoryl-1,3-thiazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(5-dimethylphosphoryl-1,3-thiazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 168874066 |
| Molecular Formula | C24H25Cl2N2O3PS |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-[(5-dimethylphosphoryl-1,3-thiazol-2-yl)methoxy]phenyl]propan-2-yl]benzonitrile |
| SMILES | CC(C)(c1ccc(OCc2ncc(P(C)(C)=O)s2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C24H25Cl2N2O3PS/c1-24(2,18-11-16(13-27)23(20(26)12-18)30-10-9-25)17-5-7-19(8-6-17)31-15-21-28-14-22(33-21)32(3,4)29/h5-8,11-12,14H,9-10,15H2,1-4H3 |
| InChIKey | DROGAVQEWZAYBC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|