C20H16Cl2N2O4S2 — CID 146520827
3-chloro-2-(2-chloroethoxy)-5-[4-[(5-methylsulfonyl-1,3-thiazol-2-yl)methoxy]phenyl]benzonitrile (PubChem CID 146520827) has the molecular formula C20H16Cl2N2O4S2 and a molecular weight of 483.40 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[4-[(5-methylsulfonyl-1,3-thiazol-2-yl)methoxy]phenyl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[4-[(5-methylsulfonyl-1,3-thiazol-2-yl)methoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 146520827 |
| Molecular Formula | C20H16Cl2N2O4S2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[4-[(5-methylsulfonyl-1,3-thiazol-2-yl)methoxy]phenyl]benzonitrile |
| SMILES | CS(=O)(=O)c1cnc(COc2ccc(-c3cc(Cl)c(OCCCl)c(C#N)c3)cc2)s1 |
| InChI | InChI=1S/C20H16Cl2N2O4S2/c1-30(25,26)19-11-24-18(29-19)12-28-16-4-2-13(3-5-16)14-8-15(10-23)20(17(22)9-14)27-7-6-21/h2-5,8-9,11H,6-7,12H2,1H3 |
| InChIKey | UNQQOMZERVHRQK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|