C22H20Cl2N4O4S — CID 170403534
N-[4-[[4-[[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]methyl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide (PubChem CID 170403534) has the molecular formula C22H20Cl2N4O4S and a molecular weight of 507.40 g/mol. Its IUPAC name is N-[4-[[4-[[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]methyl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide.
| Compound Name | N-[4-[[4-[[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]methyl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170403534 |
| Molecular Formula | C22H20Cl2N4O4S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | N-[4-[[4-[[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]methyl]phenoxy]methyl]pyrimidin-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nccc(COc2ccc(Cc3cc(Cl)c(OCCCl)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C22H20Cl2N4O4S/c1-33(29,30)28-22-26-8-6-18(27-22)14-32-19-4-2-15(3-5-19)10-16-11-17(13-25)21(20(24)12-16)31-9-7-23/h2-6,8,11-12H,7,9-10,14H2,1H3,(H,26,27,28) |
| InChIKey | CCNWQCIQLUMHNV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|