C12H16O3 — CID 166091383
ethyl (Z,2E)-2-(2-methylideneoxolan-3-ylidene)pent-3-enoate (PubChem CID 166091383) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is ethyl (Z,2E)-2-(2-methylideneoxolan-3-ylidene)pent-3-enoate.
| Compound Name | ethyl (Z,2E)-2-(2-methylideneoxolan-3-ylidene)pent-3-enoate |
|---|---|
| PubChem CID | 166091383 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethyl (Z,2E)-2-(2-methylideneoxolan-3-ylidene)pent-3-enoate |
| SMILES | C=C1OCC/C1=C(/C=C\C)C(=O)OCC |
| InChI | InChI=1S/C12H16O3/c1-4-6-11(12(13)14-5-2)10-7-8-15-9(10)3/h4,6H,3,5,7-8H2,1-2H3/b6-4-,11-10+ |
| InChIKey | FZOUPGDFQYQDOG-NIRQPQSLSA-N |
| XLogP | 2.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|