About ethane;1-methoxy-3-methylbutane;1-methylpiperazine
ethane;1-methoxy-3-methylbutane;1-methylpiperazine (PubChem CID 166092386) has the molecular formula C13H32N2O
and a molecular weight of 232.41 g/mol. Its IUPAC name is ethane;1-methoxy-3-methylbutane;1-methylpiperazine.
Molecular Properties
| Compound Name | ethane;1-methoxy-3-methylbutane;1-methylpiperazine |
| PubChem CID | 166092386 |
| Molecular Formula | C13H32N2O |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.25 |
| IUPAC Name | ethane;1-methoxy-3-methylbutane;1-methylpiperazine |
| SMILES | CC.CN1CCNCC1.COCCC(C)C |
| InChI | InChI=1S/C6H14O.C5H12N2.C2H6/c1-6(2)4-5-7-3;1-7-4-2-6-3-5-7;1-2/h6H,4-5H2,1-3H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | BRSBRFRJVWYYMK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methoxy-3-methylbutane;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-3-methylbutane;1-methylpiperazine?
The IUPAC name of ethane;1-methoxy-3-methylbutane;1-methylpiperazine (CID 166092386) is ethane;1-methoxy-3-methylbutane;1-methylpiperazine.
What is the SMILES notation for ethane;1-methoxy-3-methylbutane;1-methylpiperazine?
The canonical SMILES for ethane;1-methoxy-3-methylbutane;1-methylpiperazine is CC.CN1CCNCC1.COCCC(C)C.
What is the InChIKey of ethane;1-methoxy-3-methylbutane;1-methylpiperazine?
The InChIKey is BRSBRFRJVWYYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C5H12N2.C2H6/c1-6(2)4-5-7-3;1-7-4-2-6-3-5-7;1-2/h6H,4-5H2,1-3H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;1-methoxy-3-methylbutane;1-methylpiperazine?
ethane;1-methoxy-3-methylbutane;1-methylpiperazine has a molecular weight of 232.41 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-3-methylbutane;1-methylpiperazine is sourced from PubChem (CID 166092386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).