C27H27FN4O — CID 166093601
5-[4-[(3aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine (PubChem CID 166093601) has the molecular formula C27H27FN4O and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-[4-[(3aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine.
| Compound Name | 5-[4-[(3aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 166093601 |
| Molecular Formula | C27H27FN4O |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 5-[4-[(3aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine |
| SMILES | C=C1NCCc2cc(-c3cc(-c4ccc(N5CC6OCC[C@H]6C5)cc4)c(F)nc3N)ccc21 |
| InChI | InChI=1S/C27H27FN4O/c1-16-22-7-4-18(12-19(22)8-10-30-16)24-13-23(26(28)31-27(24)29)17-2-5-21(6-3-17)32-14-20-9-11-33-25(20)15-32/h2-7,12-13,20,25,30H,1,8-11,14-15H2,(H2,29,31)/t20-,25?/m0/s1 |
| InChIKey | NCUWMQRIFAJYQH-JINQPTGOSA-N |
| XLogP | 4.48 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|