C25H25FN4 — CID 166093633
6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)-5-(4-pyrrolidin-1-ylphenyl)pyridin-2-amine (PubChem CID 166093633) has the molecular formula C25H25FN4 and a molecular weight of 400.50 g/mol. Its IUPAC name is 6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)-5-(4-pyrrolidin-1-ylphenyl)pyridin-2-amine.
| Compound Name | 6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)-5-(4-pyrrolidin-1-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 166093633 |
| Molecular Formula | C25H25FN4 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)-5-(4-pyrrolidin-1-ylphenyl)pyridin-2-amine |
| SMILES | C=C1NCCc2cc(-c3cc(-c4ccc(N5CCCC5)cc4)c(F)nc3N)ccc21 |
| InChI | InChI=1S/C25H25FN4/c1-16-21-9-6-18(14-19(21)10-11-28-16)23-15-22(24(26)29-25(23)27)17-4-7-20(8-5-17)30-12-2-3-13-30/h4-9,14-15,28H,1-3,10-13H2,(H2,27,29) |
| InChIKey | JOLZCGCLGFSRFK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|