C20H24FN3O3S — CID 16609667
[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone (PubChem CID 16609667) has the molecular formula C20H24FN3O3S and a molecular weight of 405.50 g/mol. Its IUPAC name is [1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone.
| Compound Name | [1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
|---|---|
| PubChem CID | 16609667 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
| SMILES | CC(C)/N=c1\ccccn1C(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN3O3S/c1-15(2)22-19-5-3-4-12-24(19)20(25)16-10-13-23(14-11-16)28(26,27)18-8-6-17(21)7-9-18/h3-9,12,15-16H,10-11,13-14H2,1-2H3/b22-19+ |
| InChIKey | VDARSDCIIHTURJ-ZBJSNUHESA-N |
| XLogP | 2.68 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |