C25H31N3O4S — CID 134035837
1-[3-[4-(2-cyclohexyliminopyridine-1-carbonyl)piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 134035837) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-[3-[4-(2-cyclohexyliminopyridine-1-carbonyl)piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[4-(2-cyclohexyliminopyridine-1-carbonyl)piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 134035837 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-[3-[4-(2-cyclohexyliminopyridine-1-carbonyl)piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)n3cccc/c3=N\C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-19(29)21-8-7-11-23(18-21)33(31,32)27-16-13-20(14-17-27)25(30)28-15-6-5-12-24(28)26-22-9-3-2-4-10-22/h5-8,11-12,15,18,20,22H,2-4,9-10,13-14,16-17H2,1H3/b26-24+ |
| InChIKey | XPAZLEGXEJPHKC-SHHOIMCASA-N |
| XLogP | 3.67 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |