C17H21F3N2O3 — CID 166098842
4-(dimethylamino)-2-[2-oxo-2-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethyl]but-2-enoic acid (PubChem CID 166098842) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-(dimethylamino)-2-[2-oxo-2-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethyl]but-2-enoic acid.
| Compound Name | 4-(dimethylamino)-2-[2-oxo-2-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethyl]but-2-enoic acid |
|---|---|
| PubChem CID | 166098842 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-(dimethylamino)-2-[2-oxo-2-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethyl]but-2-enoic acid |
| SMILES | C[C@H](NC(=O)CC(=CCN(C)C)C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-11(12-4-6-14(7-5-12)17(18,19)20)21-15(23)10-13(16(24)25)8-9-22(2)3/h4-8,11H,9-10H2,1-3H3,(H,21,23)(H,24,25)/t11-/m0/s1 |
| InChIKey | CGPWOOZIHWUQEN-NSHDSACASA-N |
| XLogP | 2.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|