C25H23FN2O2 — CID 166099931
(4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-phenylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone (PubChem CID 166099931) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-phenylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone.
| Compound Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-phenylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
|---|---|
| PubChem CID | 166099931 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-phenylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#Cc3ccccc3)c1O2)C12CCC(F)(CC1)C2 |
| InChI | InChI=1S/C25H23FN2O2/c26-25-10-8-24(16-25,9-11-25)23(29)28-15-19-12-21(28)20-14-27-13-18(22(20)30-19)7-6-17-4-2-1-3-5-17/h1-5,13-14,19,21H,8-12,15-16H2/t19-,21-,24?,25?/m0/s1 |
| InChIKey | UBHUPSBNLNDSJV-MJWCVAKGSA-N |
| XLogP | 4.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|