C16H17F2N3O — CID 166099976
11-(3,3-difluoro-2,2-dimethylpropanoyl)-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile (PubChem CID 166099976) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 11-(3,3-difluoro-2,2-dimethylpropanoyl)-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile.
| Compound Name | 11-(3,3-difluoro-2,2-dimethylpropanoyl)-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
|---|---|
| PubChem CID | 166099976 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 11-(3,3-difluoro-2,2-dimethylpropanoyl)-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
| SMILES | CC(C)(C(=O)N1CC2Cc3c(C#N)cncc3C1C2)C(F)F |
| InChI | InChI=1S/C16H17F2N3O/c1-16(2,14(17)18)15(22)21-8-9-3-11-10(5-19)6-20-7-12(11)13(21)4-9/h6-7,9,13-14H,3-4,8H2,1-2H3 |
| InChIKey | HMYZOLDIKRRHMJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |