C16H16FN3O2 — CID 166100331
tert-butyl 4-[(2-cyano-5-fluorophenyl)methyl]pyrazole-1-carboxylate (PubChem CID 166100331) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is tert-butyl 4-[(2-cyano-5-fluorophenyl)methyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-cyano-5-fluorophenyl)methyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 166100331 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | tert-butyl 4-[(2-cyano-5-fluorophenyl)methyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Cc2cc(F)ccc2C#N)cn1 |
| InChI | InChI=1S/C16H16FN3O2/c1-16(2,3)22-15(21)20-10-11(9-19-20)6-13-7-14(17)5-4-12(13)8-18/h4-5,7,9-10H,6H2,1-3H3 |
| InChIKey | HVBUPCINXNQHOU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |