C17H16F3N3O2 — CID 166100292
tert-butyl 4-[[2-cyano-4-(trifluoromethyl)phenyl]methyl]pyrazole-1-carboxylate (PubChem CID 166100292) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is tert-butyl 4-[[2-cyano-4-(trifluoromethyl)phenyl]methyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-cyano-4-(trifluoromethyl)phenyl]methyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 166100292 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | tert-butyl 4-[[2-cyano-4-(trifluoromethyl)phenyl]methyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Cc2ccc(C(F)(F)F)cc2C#N)cn1 |
| InChI | InChI=1S/C17H16F3N3O2/c1-16(2,3)25-15(24)23-10-11(9-22-23)6-12-4-5-14(17(18,19)20)7-13(12)8-21/h4-5,7,9-10H,6H2,1-3H3 |
| InChIKey | FAMPRGGLWJXWLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |