C20H27F3N4O2 — CID 18727097
tert-butyl N-[2-[[1-[2-cyano-4-(trifluoromethyl)phenyl]piperidin-4-yl]amino]ethyl]carbamate (PubChem CID 18727097) has the molecular formula C20H27F3N4O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-cyano-4-(trifluoromethyl)phenyl]piperidin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-cyano-4-(trifluoromethyl)phenyl]piperidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 18727097 |
| Molecular Formula | C20H27F3N4O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-cyano-4-(trifluoromethyl)phenyl]piperidin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC1CCN(c2ccc(C(F)(F)F)cc2C#N)CC1 |
| InChI | InChI=1S/C20H27F3N4O2/c1-19(2,3)29-18(28)26-9-8-25-16-6-10-27(11-7-16)17-5-4-15(20(21,22)23)12-14(17)13-24/h4-5,12,16,25H,6-11H2,1-3H3,(H,26,28) |
| InChIKey | YJSUMBRTLSUJLN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|