C14H8BrF2N3O — CID 166102479
(4-amino-3,5-difluorophenyl)-(8-bromoimidazo[1,2-a]pyridin-3-yl)methanone (PubChem CID 166102479) has the molecular formula C14H8BrF2N3O and a molecular weight of 352.14 g/mol. Its IUPAC name is (4-amino-3,5-difluorophenyl)-(8-bromoimidazo[1,2-a]pyridin-3-yl)methanone.
| Compound Name | (4-amino-3,5-difluorophenyl)-(8-bromoimidazo[1,2-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 166102479 |
| Molecular Formula | C14H8BrF2N3O |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | (4-amino-3,5-difluorophenyl)-(8-bromoimidazo[1,2-a]pyridin-3-yl)methanone |
| SMILES | Nc1c(F)cc(C(=O)c2cnc3c(Br)cccn23)cc1F |
| InChI | InChI=1S/C14H8BrF2N3O/c15-8-2-1-3-20-11(6-19-14(8)20)13(21)7-4-9(16)12(18)10(17)5-7/h1-6H,18H2 |
| InChIKey | SQQPEUYBHNFOFM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|