C32H33Cl2F2N5O — CID 166102808
6-chloro-7-(4-chloronaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxyquinazoline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 166102808) has the molecular formula C32H33Cl2F2N5O and a molecular weight of 612.55 g/mol. Its IUPAC name is 6-chloro-7-(4-chloronaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxyquinazoline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 6-chloro-7-(4-chloronaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxyquinazoline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 166102808 |
| Molecular Formula | C32H33Cl2F2N5O |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 6-chloro-7-(4-chloronaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxyquinazoline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc(N2CC3CCC(C2)N3)c2cc(Cl)c(-c3ccc(Cl)c4ccccc34)c(F)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C25H21Cl2FN4O.C7H12FN/c1-33-25-30-23-18(24(31-25)32-11-13-6-7-14(12-32)29-13)10-20(27)21(22(23)28)17-8-9-19(26)16-5-3-2-4-15(16)17;8-6-4-7-2-1-3-9(7)5-6/h2-5,8-10,13-14,29H,6-7,11-12H2,1H3;6-7H,1-5H2 |
| InChIKey | UUFNSNTZSNMWNO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |