C30H38F2N6O2 — CID 156645746
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxy-7-(2-propan-2-yloxyphenyl)pyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 156645746) has the molecular formula C30H38F2N6O2 and a molecular weight of 552.67 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxy-7-(2-propan-2-yloxyphenyl)pyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxy-7-(2-propan-2-yloxyphenyl)pyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 156645746 |
| Molecular Formula | C30H38F2N6O2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-methoxy-7-(2-propan-2-yloxyphenyl)pyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc(N2CC3CCC(C2)N3)c2cnc(-c3ccccc3OC(C)C)c(F)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C23H26FN5O2.C7H12FN/c1-13(2)31-18-7-5-4-6-16(18)20-19(24)21-17(10-25-20)22(28-23(27-21)30-3)29-11-14-8-9-15(12-29)26-14;8-6-4-7-2-1-3-9(7)5-6/h4-7,10,13-15,26H,8-9,11-12H2,1-3H3;6-7H,1-5H2 |
| InChIKey | JBYRUYXTXJLCAQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |