C25H34ClFN6OS — CID 172588177
10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 172588177) has the molecular formula C25H34ClFN6OS and a molecular weight of 521.11 g/mol. Its IUPAC name is 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 172588177 |
| Molecular Formula | C25H34ClFN6OS |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methoxy-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CC.COc1nc(N2CC3CCC(C2)N3)c2c(n1)sc1c(Cl)nccc12.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C16H16ClN5OS.C7H12FN.C2H6/c1-23-16-20-14(22-6-8-2-3-9(7-22)19-8)11-10-4-5-18-13(17)12(10)24-15(11)21-16;8-6-4-7-2-1-3-9(7)5-6;1-2/h4-5,8-9,19H,2-3,6-7H2,1H3;6-7H,1-5H2;1-2H3 |
| InChIKey | XVOXLJNJRBJIIA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|