C18H22ClN5S2 — CID 178018922
10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane (PubChem CID 178018922) has the molecular formula C18H22ClN5S2 and a molecular weight of 408.00 g/mol. Its IUPAC name is 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane.
| Compound Name | 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane |
|---|---|
| PubChem CID | 178018922 |
| Molecular Formula | C18H22ClN5S2 |
| Molecular Weight | 408.00 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 10-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-methylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;ethane |
| SMILES | CC.CSc1nc(N2CC3CCC(C2)N3)c2c(n1)sc1c(Cl)nccc12 |
| InChI | InChI=1S/C16H16ClN5S2.C2H6/c1-23-16-20-14(22-6-8-2-3-9(7-22)19-8)11-10-4-5-18-13(17)12(10)24-15(11)21-16;1-2/h4-5,8-9,19H,2-3,6-7H2,1H3;1-2H3 |
| InChIKey | SNMPRMQGLWWJJW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.00 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|