C32H30FN7S — CID 172588032
3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-10-(5-ethynyl-6-fluoro-1H-benzo[f]indazol-4-yl)-5-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;propane (PubChem CID 172588032) has the molecular formula C32H30FN7S and a molecular weight of 563.71 g/mol. Its IUPAC name is 3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-10-(5-ethynyl-6-fluoro-1H-benzo[f]indazol-4-yl)-5-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;propane.
| Compound Name | 3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-10-(5-ethynyl-6-fluoro-1H-benzo[f]indazol-4-yl)-5-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;propane |
|---|---|
| PubChem CID | 172588032 |
| Molecular Formula | C32H30FN7S |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 3-(3,8-diazabicyclo[3.2.1]octan-3-yl)-10-(5-ethynyl-6-fluoro-1H-benzo[f]indazol-4-yl)-5-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene;propane |
| SMILES | C#Cc1c(F)ccc2cc3[nH]ncc3c(-c3nccc4c3sc3nc(C)nc(N5CC6CCC(C5)N6)c34)c12.CCC |
| InChI | InChI=1S/C29H22FN7S.C3H8/c1-3-18-21(30)7-4-15-10-22-20(11-32-36-22)24(23(15)18)26-27-19(8-9-31-26)25-28(33-14(2)34-29(25)38-27)37-12-16-5-6-17(13-37)35-16;1-3-2/h1,4,7-11,16-17,35H,5-6,12-13H2,2H3,(H,32,36);3H2,1-2H3 |
| InChIKey | YSCICJLNFWOBFT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|