C33H38F3N7O — CID 172577123
acetonitrile;7-(8-ethyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-methoxy-4-piperazin-1-ylpyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 172577123) has the molecular formula C33H38F3N7O and a molecular weight of 605.71 g/mol. Its IUPAC name is acetonitrile;7-(8-ethyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-methoxy-4-piperazin-1-ylpyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | acetonitrile;7-(8-ethyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-methoxy-4-piperazin-1-ylpyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 172577123 |
| Molecular Formula | C33H38F3N7O |
| Molecular Weight | 605.71 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | acetonitrile;7-(8-ethyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-methoxy-4-piperazin-1-ylpyrido[4,3-d]pyrimidine;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CC#N.CCc1c(F)ccc2cccc(-c3ncc4c(N5CCNCC5)nc(OC)nc4c3F)c12.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C24H23F2N5O.C7H12FN.C2H3N/c1-3-15-18(25)8-7-14-5-4-6-16(19(14)15)21-20(26)22-17(13-28-21)23(30-24(29-22)32-2)31-11-9-27-10-12-31;8-6-4-7-2-1-3-9(7)5-6;1-2-3/h4-8,13,27H,3,9-12H2,1-2H3;6-7H,1-5H2;1H3 |
| InChIKey | VFWSBKPGWMJKGU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |