C29H31F2N7OS — CID 166103061
4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine (PubChem CID 166103061) has the molecular formula C29H31F2N7OS and a molecular weight of 563.68 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 166103061 |
| Molecular Formula | C29H31F2N7OS |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(-c3cc4nc(OCC56CCCN5CCC6)nc(N5C6CCC5CNC6)c4cc3F)ccc(F)c2s1 |
| InChI | InChI=1S/C29H31F2N7OS/c30-21-6-5-18(24-25(21)40-27(32)35-24)19-12-23-20(11-22(19)31)26(38-16-3-4-17(38)14-33-13-16)36-28(34-23)39-15-29-7-1-9-37(29)10-2-8-29/h5-6,11-12,16-17,33H,1-4,7-10,13-15H2,(H2,32,35) |
| InChIKey | ZMRBXIOKJXJJBC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |