C29H28F5N7OS — CID 177213361
4-[4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine (PubChem CID 177213361) has the molecular formula C29H28F5N7OS and a molecular weight of 617.65 g/mol. Its IUPAC name is 4-[4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | 4-[4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 177213361 |
| Molecular Formula | C29H28F5N7OS |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 4-[4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(-c3c(F)cc4c(N5CCNC(C=C(F)F)C5)nc(OCC56CCCN5CCC6)nc4c3F)ccc(F)c2s1 |
| InChI | InChI=1S/C29H28F5N7OS/c30-18-4-3-16(24-25(18)43-27(35)37-24)21-19(31)12-17-23(22(21)34)38-28(42-14-29-5-1-8-41(29)9-2-6-29)39-26(17)40-10-7-36-15(13-40)11-20(32)33/h3-4,11-12,15,36H,1-2,5-10,13-14H2,(H2,35,37) |
| InChIKey | UVGLHMUVVBJVCT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |