C37H42ClF4N5O2 — CID 177213385
4-[6-chloro-4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoro-5-propan-2-ylnaphthalen-2-ol;ethane (PubChem CID 177213385) has the molecular formula C37H42ClF4N5O2 and a molecular weight of 700.22 g/mol. Its IUPAC name is 4-[6-chloro-4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoro-5-propan-2-ylnaphthalen-2-ol;ethane.
| Compound Name | 4-[6-chloro-4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoro-5-propan-2-ylnaphthalen-2-ol;ethane |
|---|---|
| PubChem CID | 177213385 |
| Molecular Formula | C37H42ClF4N5O2 |
| Molecular Weight | 700.22 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | 4-[6-chloro-4-[3-(2,2-difluoroethenyl)piperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-6-fluoro-5-propan-2-ylnaphthalen-2-ol;ethane |
| SMILES | CC.CC(C)c1c(F)ccc2cc(O)cc(-c3c(Cl)cc4c(N5CCNC(C=C(F)F)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C35H36ClF4N5O2.C2H6/c1-19(2)28-26(37)6-5-20-13-22(46)15-23(29(20)28)30-25(36)16-24-32(31(30)40)42-34(47-18-35-7-3-10-45(35)11-4-8-35)43-33(24)44-12-9-41-21(17-44)14-27(38)39;1-2/h5-6,13-16,19,21,41,46H,3-4,7-12,17-18H2,1-2H3;1-2H3 |
| InChIKey | VHVAAFCXWSGILS-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.22 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |