C27H26N4O5 — CID 166105733
2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(1H-indol-5-ylmethyl)piperidin-4-yl]isoindole-1,3-dione (PubChem CID 166105733) has the molecular formula C27H26N4O5 and a molecular weight of 486.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(1H-indol-5-ylmethyl)piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(1H-indol-5-ylmethyl)piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166105733 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(1H-indol-5-ylmethyl)piperidin-4-yl]isoindole-1,3-dione |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)C4(CCN(CC4)CC5=CC6=C(C=C5)NC=C6)O |
| InChI | InChI=1S/C27H26N4O5/c32-23-6-5-22(24(33)29-23)31-25(34)19-3-2-18(14-20(19)26(31)35)27(36)8-11-30(12-9-27)15-16-1-4-21-17(13-16)7-10-28-21/h1-4,7,10,13-14,22,28,36H,5-6,8-9,11-12,15H2,(H,29,32,33) |
| InChIKey | YNIKPEGHTYRRQL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | 931 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|