C26H25N5O5 — CID 171763144
2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)piperidin-4-yl]isoindole-1,3-dione (PubChem CID 171763144) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171763144 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)piperidin-4-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C4(O)CCN(Cc5cccn6nccc56)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25N5O5/c32-22-6-5-21(23(33)28-22)31-24(34)18-4-3-17(14-19(18)25(31)35)26(36)8-12-29(13-9-26)15-16-2-1-11-30-20(16)7-10-27-30/h1-4,7,10-11,14,21,36H,5-6,8-9,12-13,15H2,(H,28,32,33) |
| InChIKey | CXTAFAYPRHSHMX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|