C19H22ClN3O5 — CID 170694202
2-(2,6-dioxopiperidin-3-yl)-5-(4-hydroxy-2-methylpiperidin-4-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 170694202) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(4-hydroxy-2-methylpiperidin-4-yl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-hydroxy-2-methylpiperidin-4-yl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 170694202 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-hydroxy-2-methylpiperidin-4-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | CC1CC(O)(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CCN1.Cl |
| InChI | InChI=1S/C19H21N3O5.ClH/c1-10-9-19(27,6-7-20-10)11-2-3-12-13(8-11)18(26)22(17(12)25)14-4-5-15(23)21-16(14)24;/h2-3,8,10,14,20,27H,4-7,9H2,1H3,(H,21,23,24);1H |
| InChIKey | DVSCIEYEQYGITM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|