C27H26F3N3O5 — CID 166105732
2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]isoindole-1,3-dione (PubChem CID 166105732) has the molecular formula C27H26F3N3O5 and a molecular weight of 529.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166105732 |
| Molecular Formula | C27H26F3N3O5 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-hydroxy-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]isoindole-1,3-dione |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)N1CCC(O)(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C27H26F3N3O5/c1-15(16-2-4-17(5-3-16)27(28,29)30)32-12-10-26(38,11-13-32)18-6-7-19-20(14-18)25(37)33(24(19)36)21-8-9-22(34)31-23(21)35/h2-7,14-15,21,38H,8-13H2,1H3,(H,31,34,35) |
| InChIKey | QPCOUVRTKAAFST-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|