C23H22F2N4O5 — CID 16610663
N-cyclopropyl-2-[[2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 16610663) has the molecular formula C23H22F2N4O5 and a molecular weight of 472.45 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-2-[[2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16610663 |
| Molecular Formula | C23H22F2N4O5 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-cyclopropyl-2-[[2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)NC2CC2)C1=O |
| InChI | InChI=1S/C23H22F2N4O5/c1-23(13-6-10-15(11-7-13)34-21(24)25)20(32)29(22(33)28-23)12-18(30)27-17-5-3-2-4-16(17)19(31)26-14-8-9-14/h2-7,10-11,14,21H,8-9,12H2,1H3,(H,26,31)(H,27,30)(H,28,33) |
| InChIKey | RXTGNHKNYOONJX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|