C24H33N3O2 — CID 166107663
tert-butyl 3-amino-3-(aminomethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 166107663) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is tert-butyl 3-amino-3-(aminomethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-3-(aminomethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166107663 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | tert-butyl 3-amino-3-(aminomethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N)(CN)C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-23(2,3)29-22(28)27-14-8-13-24(26,17-25)21(27)16-18-9-7-12-20(15-18)19-10-5-4-6-11-19/h4-7,9-12,15,21H,8,13-14,16-17,25-26H2,1-3H3 |
| InChIKey | QFVFLQYLFSOQPE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |