C28H39N3O5S — CID 166107476
tert-butyl 3-[[(R)-tert-butylsulfinyl]amino]-3-(nitromethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 166107476) has the molecular formula C28H39N3O5S and a molecular weight of 529.70 g/mol. Its IUPAC name is tert-butyl 3-[[(R)-tert-butylsulfinyl]amino]-3-(nitromethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(R)-tert-butylsulfinyl]amino]-3-(nitromethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166107476 |
| Molecular Formula | C28H39N3O5S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | tert-butyl 3-[[(R)-tert-butylsulfinyl]amino]-3-(nitromethyl)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C[N+](=O)[O-])(N[S@](=O)C(C)(C)C)C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H39N3O5S/c1-26(2,3)36-25(32)30-17-11-16-28(20-31(33)34,29-37(35)27(4,5)6)24(30)19-21-12-10-15-23(18-21)22-13-8-7-9-14-22/h7-10,12-15,18,24,29H,11,16-17,19-20H2,1-6H3/t24?,28?,37-/m1/s1 |
| InChIKey | CKMUYHRIAZTMCG-GBJVXAGESA-N |
| XLogP | 5.36 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|