C26H38FN3O4 — CID 166107827
(1S,8S,9S)-N-ethyl-4-fluoro-8-methyl-5-oxo-7-(4-phenylcyclohexyl)oxy-3-oxa-6,10-diazatricyclo[7.4.0.01,6]tridecane-10-carboxamide;molecular hydrogen (PubChem CID 166107827) has the molecular formula C26H38FN3O4 and a molecular weight of 475.61 g/mol. Its IUPAC name is (1S,8S,9S)-N-ethyl-4-fluoro-8-methyl-5-oxo-7-(4-phenylcyclohexyl)oxy-3-oxa-6,10-diazatricyclo[7.4.0.01,6]tridecane-10-carboxamide;molecular hydrogen.
| Compound Name | (1S,8S,9S)-N-ethyl-4-fluoro-8-methyl-5-oxo-7-(4-phenylcyclohexyl)oxy-3-oxa-6,10-diazatricyclo[7.4.0.01,6]tridecane-10-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 166107827 |
| Molecular Formula | C26H38FN3O4 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (1S,8S,9S)-N-ethyl-4-fluoro-8-methyl-5-oxo-7-(4-phenylcyclohexyl)oxy-3-oxa-6,10-diazatricyclo[7.4.0.01,6]tridecane-10-carboxamide;molecular hydrogen |
| SMILES | CCNC(=O)N1CCC[C@]23COC(F)C(=O)N2C(OC2CCC(c4ccccc4)CC2)[C@@H](C)[C@H]13.[H][H] |
| InChI | InChI=1S/C26H36FN3O4.H2/c1-3-28-25(32)29-15-7-14-26-16-33-22(27)23(31)30(26)24(17(2)21(26)29)34-20-12-10-19(11-13-20)18-8-5-4-6-9-18;/h4-6,8-9,17,19-22,24H,3,7,10-16H2,1-2H3,(H,28,32);1H/t17-,19?,20?,21-,22?,24?,26+;/m0./s1 |
| InChIKey | HAYVXAKZZIFHFQ-GDZZHYRJSA-N |
| XLogP | 4.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |