C24H39N3O4 — CID 166107611
2-[1-(ethylcarbamoyl)piperidin-3-yl]ethyl carbamate;(4-methoxycyclohexyl)benzene (PubChem CID 166107611) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[1-(ethylcarbamoyl)piperidin-3-yl]ethyl carbamate;(4-methoxycyclohexyl)benzene.
| Compound Name | 2-[1-(ethylcarbamoyl)piperidin-3-yl]ethyl carbamate;(4-methoxycyclohexyl)benzene |
|---|---|
| PubChem CID | 166107611 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 2-[1-(ethylcarbamoyl)piperidin-3-yl]ethyl carbamate;(4-methoxycyclohexyl)benzene |
| SMILES | CCNC(=O)N1CCCC(CCOC(N)=O)C1.COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H18O.C11H21N3O3/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-13-11(16)14-6-3-4-9(8-14)5-7-17-10(12)15/h2-6,12-13H,7-10H2,1H3;9H,2-8H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | CAZNASSRNNDUGB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |