C17H21ClN4O3S2 — CID 166108340
1-[4-[(5-chlorothiophen-2-yl)-cyanomethylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide (PubChem CID 166108340) has the molecular formula C17H21ClN4O3S2 and a molecular weight of 428.97 g/mol. Its IUPAC name is 1-[4-[(5-chlorothiophen-2-yl)-cyanomethylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide.
| Compound Name | 1-[4-[(5-chlorothiophen-2-yl)-cyanomethylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 166108340 |
| Molecular Formula | C17H21ClN4O3S2 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-[4-[(5-chlorothiophen-2-yl)-cyanomethylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide |
| SMILES | N#CC(=C1CCN(C(=O)N2CCC(S(N)(=O)=O)CC2)CC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H21ClN4O3S2/c18-16-2-1-15(26-16)14(11-19)12-3-7-21(8-4-12)17(23)22-9-5-13(6-10-22)27(20,24)25/h1-2,13H,3-10H2,(H2,20,24,25) |
| InChIKey | OHSYJLWIOVHJBG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|