C10H8F3N3OS — CID 166109272
3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 166109272) has the molecular formula C10H8F3N3OS and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166109272 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1nc(-c2cc3c(s2)CNCC3)no1 |
| InChI | InChI=1S/C10H8F3N3OS/c11-10(12,13)9-15-8(16-17-9)6-3-5-1-2-14-4-7(5)18-6/h3,14H,1-2,4H2 |
| InChIKey | PJFRGAKCFYXWSD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |