About 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid
2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid (PubChem CID 166111060) has the molecular formula C28H28F2O4
and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid |
| PubChem CID | 166111060 |
| Molecular Formula | C28H28F2O4 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid |
| SMILES | C.Cc1cc(C(C)C)c2oc(-c3cc(F)cc(F)c3)cc(=O)c2c1.Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H16F2O2.C8H8O2.CH4/c1-10(2)15-4-11(3)5-16-17(22)9-18(23-19(15)16)12-6-13(20)8-14(21)7-12;1-6-4-2-3-5-7(6)8(9)10;/h4-10H,1-3H3;2-5H,1H3,(H,9,10);1H4 |
| InChIKey | KFMSMXPOXWBRFJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid?
The IUPAC name of 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid (CID 166111060) is 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid.
What is the SMILES notation for 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid?
The canonical SMILES for 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid is C.Cc1cc(C(C)C)c2oc(-c3cc(F)cc(F)c3)cc(=O)c2c1.Cc1ccccc1C(=O)O.
What is the InChIKey of 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid?
The InChIKey is KFMSMXPOXWBRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2O2.C8H8O2.CH4/c1-10(2)15-4-11(3)5-16-17(22)9-18(23-19(15)16)12-6-13(20)8-14(21)7-12;1-6-4-2-3-5-7(6)8(9)10;/h4-10H,1-3H3;2-5H,1H3,(H,9,10);1H4.
What are the key properties of 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid?
2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid has a molecular weight of 466.52 g/mol, XLogP of 7.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-6-methyl-8-propan-2-ylchromen-4-one;methane;2-methylbenzoic acid is sourced from PubChem (CID 166111060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).